C42H45F2N3 — CID 21352399
N-(3,4-difluorophenyl)-1-[[3-(3,4,5-trimethylphenyl)phenyl]methyl]-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine (PubChem CID 21352399) has the molecular formula C42H45F2N3 and a molecular weight of 629.84 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-[[3-(3,4,5-trimethylphenyl)phenyl]methyl]-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-(3,4-difluorophenyl)-1-[[3-(3,4,5-trimethylphenyl)phenyl]methyl]-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 21352399 |
| Molecular Formula | C42H45F2N3 |
| Molecular Weight | 629.84 g/mol |
| Exact Mass | 629.36 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-[[3-(3,4,5-trimethylphenyl)phenyl]methyl]-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
| SMILES | Cc1cc(-c2cccc(CN3CCC(N(Cc4ccnc(-c5cc(C)c(C)c(C)c5)c4)c4ccc(F)c(F)c4)CC3)c2)cc(C)c1C |
| InChI | InChI=1S/C42H45F2N3/c1-27-18-36(19-28(2)31(27)5)35-9-7-8-33(22-35)25-46-16-13-38(14-17-46)47(39-10-11-40(43)41(44)24-39)26-34-12-15-45-42(23-34)37-20-29(3)32(6)30(4)21-37/h7-12,15,18-24,38H,13-14,16-17,25-26H2,1-6H3 |
| InChIKey | VVDMWVNSJODZAU-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.84 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |