C44H47F3N2O — CID 21352465
N-[4-(trifluoromethoxy)phenyl]-N,1-bis[[3-(3,4,5-trimethylphenyl)phenyl]methyl]piperidin-4-amine (PubChem CID 21352465) has the molecular formula C44H47F3N2O and a molecular weight of 676.87 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-N,1-bis[[3-(3,4,5-trimethylphenyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-N,1-bis[[3-(3,4,5-trimethylphenyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 21352465 |
| Molecular Formula | C44H47F3N2O |
| Molecular Weight | 676.87 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-N,1-bis[[3-(3,4,5-trimethylphenyl)phenyl]methyl]piperidin-4-amine |
| SMILES | Cc1cc(-c2cccc(CN3CCC(N(Cc4cccc(-c5cc(C)c(C)c(C)c5)c4)c4ccc(OC(F)(F)F)cc4)CC3)c2)cc(C)c1C |
| InChI | InChI=1S/C44H47F3N2O/c1-29-21-39(22-30(2)33(29)5)37-11-7-9-35(25-37)27-48-19-17-42(18-20-48)49(41-13-15-43(16-14-41)50-44(45,46)47)28-36-10-8-12-38(26-36)40-23-31(3)34(6)32(4)24-40/h7-16,21-26,42H,17-20,27-28H2,1-6H3 |
| InChIKey | AELCXDWVLOXZCS-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.87 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|