C27H33N3 — CID 21352564
N-(4-methylphenyl)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine (PubChem CID 21352564) has the molecular formula C27H33N3 and a molecular weight of 399.58 g/mol. Its IUPAC name is N-(4-methylphenyl)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-(4-methylphenyl)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 21352564 |
| Molecular Formula | C27H33N3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | N-(4-methylphenyl)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
| SMILES | Cc1ccc(N(Cc2ccnc(-c3cc(C)c(C)c(C)c3)c2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C27H33N3/c1-19-5-7-25(8-6-19)30(26-10-12-28-13-11-26)18-23-9-14-29-27(17-23)24-15-20(2)22(4)21(3)16-24/h5-9,14-17,26,28H,10-13,18H2,1-4H3 |
| InChIKey | KNVASUCSSQUYPG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|