C29H34FN3O2 — CID 21352581
tert-butyl 4-[N-[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-4-methylanilino]piperidine-1-carboxylate (PubChem CID 21352581) has the molecular formula C29H34FN3O2 and a molecular weight of 475.61 g/mol. Its IUPAC name is tert-butyl 4-[N-[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-4-methylanilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[N-[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-4-methylanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 21352581 |
| Molecular Formula | C29H34FN3O2 |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | tert-butyl 4-[N-[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-4-methylanilino]piperidine-1-carboxylate |
| SMILES | Cc1ccc(N(Cc2ccnc(-c3cccc(F)c3)c2)C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H34FN3O2/c1-21-8-10-25(11-9-21)33(26-13-16-32(17-14-26)28(34)35-29(2,3)4)20-22-12-15-31-27(18-22)23-6-5-7-24(30)19-23/h5-12,15,18-19,26H,13-14,16-17,20H2,1-4H3 |
| InChIKey | KMQDSDCOWWQFIH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|