C43H39N3O5 — CID 21352880
benzyl (2S)-4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1-trityl-2,5-dihydropyrrole-2-carboxylate (PubChem CID 21352880) has the molecular formula C43H39N3O5 and a molecular weight of 677.80 g/mol. Its IUPAC name is benzyl (2S)-4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1-trityl-2,5-dihydropyrrole-2-carboxylate.
| Compound Name | benzyl (2S)-4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1-trityl-2,5-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 21352880 |
| Molecular Formula | C43H39N3O5 |
| Molecular Weight | 677.80 g/mol |
| Exact Mass | 677.29 |
| IUPAC Name | benzyl (2S)-4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1-trityl-2,5-dihydropyrrole-2-carboxylate |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(C3=C[C@@H](C(=O)OCc4ccccc4)N(C(c4ccccc4)(c4ccccc4)c4ccccc4)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C43H39N3O5/c1-31(47)44-27-39-29-45(42(49)51-39)38-24-22-33(23-25-38)34-26-40(41(48)50-30-32-14-6-2-7-15-32)46(28-34)43(35-16-8-3-9-17-35,36-18-10-4-11-19-36)37-20-12-5-13-21-37/h2-26,39-40H,27-30H2,1H3,(H,44,47)/t39-,40-/m0/s1 |
| InChIKey | WJWQHZXKYIOZNC-ZAQUEYBZSA-N |
| XLogP | 6.95 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.80 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|