About 3H-pyrrolo[1,2-c]imidazole
3H-pyrrolo[1,2-c]imidazole (PubChem CID 21352920) has the molecular formula C6H6N2
and a molecular weight of 106.13 g/mol. Its IUPAC name is 3H-pyrrolo[1,2-c]imidazole.
Molecular Properties
| Compound Name | 3H-pyrrolo[1,2-c]imidazole |
| PubChem CID | 21352920 |
| Molecular Formula | C6H6N2 |
| Molecular Weight | 106.13 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | 3H-pyrrolo[1,2-c]imidazole |
| SMILES | C1=NCn2cccc21 |
| InChI | InChI=1S/C6H6N2/c1-2-6-4-7-5-8(6)3-1/h1-4H,5H2 |
| InChIKey | QNPRCRKKCVQFSO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.13 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-pyrrolo[1,2-c]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrrolo[1,2-c]imidazole?
The IUPAC name of 3H-pyrrolo[1,2-c]imidazole (CID 21352920) is 3H-pyrrolo[1,2-c]imidazole.
What is the SMILES notation for 3H-pyrrolo[1,2-c]imidazole?
The canonical SMILES for 3H-pyrrolo[1,2-c]imidazole is C1=NCn2cccc21.
What is the InChIKey of 3H-pyrrolo[1,2-c]imidazole?
The InChIKey is QNPRCRKKCVQFSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2/c1-2-6-4-7-5-8(6)3-1/h1-4H,5H2.
What are the key properties of 3H-pyrrolo[1,2-c]imidazole?
3H-pyrrolo[1,2-c]imidazole has a molecular weight of 106.13 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrrolo[1,2-c]imidazole is sourced from PubChem (CID 21352920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).