About N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine
N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 21352979) has the molecular formula C26H29FN4
and a molecular weight of 416.54 g/mol. Its IUPAC name is N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine.
Molecular Properties
| Compound Name | N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine |
| PubChem CID | 21352979 |
| Molecular Formula | C26H29FN4 |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | CCCCN(CCCC)c1ccc2c(-c3ccncc3)c(-c3ccc(F)cc3)[nH]c2n1 |
| InChI | InChI=1S/C26H29FN4/c1-3-5-17-31(18-6-4-2)23-12-11-22-24(19-13-15-28-16-14-19)25(30-26(22)29-23)20-7-9-21(27)10-8-20/h7-16H,3-6,17-18H2,1-2H3,(H,29,30) |
| InChIKey | DGLOAUXMABCTSL-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine?
The IUPAC name of N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine (CID 21352979) is N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine.
What is the SMILES notation for N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine?
The canonical SMILES for N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine is CCCCN(CCCC)c1ccc2c(-c3ccncc3)c(-c3ccc(F)cc3)[nH]c2n1.
What is the InChIKey of N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine?
The InChIKey is DGLOAUXMABCTSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29FN4/c1-3-5-17-31(18-6-4-2)23-12-11-22-24(19-13-15-28-16-14-19)25(30-26(22)29-23)20-7-9-21(27)10-8-20/h7-16H,3-6,17-18H2,1-2H3,(H,29,30).
What are the key properties of N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine?
N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine has a molecular weight of 416.54 g/mol, XLogP of 6.84, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-2-(4-fluorophenyl)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine is sourced from PubChem (CID 21352979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).