C18H25N7O8S2 — CID 21353392
4-[[4-[2-hydroxyethyl-[2-(3-methyl-1,1-dioxothiaziridin-2-yl)ethyl]amino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 21353392) has the molecular formula C18H25N7O8S2 and a molecular weight of 531.57 g/mol. Its IUPAC name is 4-[[4-[2-hydroxyethyl-[2-(3-methyl-1,1-dioxothiaziridin-2-yl)ethyl]amino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-[2-hydroxyethyl-[2-(3-methyl-1,1-dioxothiaziridin-2-yl)ethyl]amino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 21353392 |
| Molecular Formula | C18H25N7O8S2 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 4-[[4-[2-hydroxyethyl-[2-(3-methyl-1,1-dioxothiaziridin-2-yl)ethyl]amino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | CC1N(CCN(CCO)c2nc(NCCS(=O)(=O)O)nc(Nc3ccc(C(=O)O)cc3)n2)S1(=O)=O |
| InChI | InChI=1S/C18H25N7O8S2/c1-12-25(35(12,32)33)8-7-24(9-10-26)18-22-16(19-6-11-34(29,30)31)21-17(23-18)20-14-4-2-13(3-5-14)15(27)28/h2-5,12,26H,6-11H2,1H3,(H,27,28)(H,29,30,31)(H2,19,20,21,22,23) |
| InChIKey | YLXSIEOAHTVVFP-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|