C56H42O8 — CID 21353442
[1,1,4,4-tetranaphthalen-2-yl-1,3,4-tri(prop-2-enoyloxy)butan-2-yl] prop-2-enoate (PubChem CID 21353442) has the molecular formula C56H42O8 and a molecular weight of 842.94 g/mol. Its IUPAC name is [1,1,4,4-tetranaphthalen-2-yl-1,3,4-tri(prop-2-enoyloxy)butan-2-yl] prop-2-enoate.
| Compound Name | [1,1,4,4-tetranaphthalen-2-yl-1,3,4-tri(prop-2-enoyloxy)butan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 21353442 |
| Molecular Formula | C56H42O8 |
| Molecular Weight | 842.94 g/mol |
| Exact Mass | 842.29 |
| IUPAC Name | [1,1,4,4-tetranaphthalen-2-yl-1,3,4-tri(prop-2-enoyloxy)butan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C(OC(=O)C=C)C(OC(=O)C=C)(c1ccc2ccccc2c1)c1ccc2ccccc2c1)C(OC(=O)C=C)(c1ccc2ccccc2c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C56H42O8/c1-5-49(57)61-53(55(63-51(59)7-3,45-29-25-37-17-9-13-21-41(37)33-45)46-30-26-38-18-10-14-22-42(38)34-46)54(62-50(58)6-2)56(64-52(60)8-4,47-31-27-39-19-11-15-23-43(39)35-47)48-32-28-40-20-12-16-24-44(40)36-48/h5-36,53-54H,1-4H2 |
| InChIKey | JFLHYUPCQAKLSG-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.94 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|