About 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine
2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine (PubChem CID 21354174) has the molecular formula C13H7BrCl2N2
and a molecular weight of 342.02 g/mol. Its IUPAC name is 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine.
Molecular Properties
| Compound Name | 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine |
| PubChem CID | 21354174 |
| Molecular Formula | C13H7BrCl2N2 |
| Molecular Weight | 342.02 g/mol |
| Exact Mass | 339.92 |
| IUPAC Name | 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine |
| SMILES | [C-]#[N+]C(c1cccc(Br)n1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H7BrCl2N2/c1-17-13(10-6-3-7-11(14)18-10)12-8(15)4-2-5-9(12)16/h2-7,13H |
| InChIKey | CGNFGNDWRUZLPT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.02 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine?
The IUPAC name of 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine (CID 21354174) is 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine.
What is the SMILES notation for 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine?
The canonical SMILES for 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine is [C-]#[N+]C(c1cccc(Br)n1)c1c(Cl)cccc1Cl.
What is the InChIKey of 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine?
The InChIKey is CGNFGNDWRUZLPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrCl2N2/c1-17-13(10-6-3-7-11(14)18-10)12-8(15)4-2-5-9(12)16/h2-7,13H.
What are the key properties of 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine?
2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine has a molecular weight of 342.02 g/mol, XLogP of 5.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine is sourced from PubChem (CID 21354174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).