About 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide
2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 21354342) has the molecular formula C11H24N2O3
and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide |
| PubChem CID | 21354342 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | CCCN(CC)CC(=O)N(CCO)CCO |
| InChI | InChI=1S/C11H24N2O3/c1-3-5-12(4-2)10-11(16)13(6-8-14)7-9-15/h14-15H,3-10H2,1-2H3 |
| InChIKey | KYPBWICEBIQZCW-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide?
The IUPAC name of 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide (CID 21354342) is 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide.
What is the SMILES notation for 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide?
The canonical SMILES for 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide is CCCN(CC)CC(=O)N(CCO)CCO.
What is the InChIKey of 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide?
The InChIKey is KYPBWICEBIQZCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O3/c1-3-5-12(4-2)10-11(16)13(6-8-14)7-9-15/h14-15H,3-10H2,1-2H3.
What are the key properties of 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide?
2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide has a molecular weight of 232.32 g/mol, XLogP of -0.47, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(propyl)amino]-N,N-bis(2-hydroxyethyl)acetamide is sourced from PubChem (CID 21354342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).