About 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one
3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one (PubChem CID 21354350) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one |
| PubChem CID | 21354350 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one |
| SMILES | CCC1C(C)CN(C)C(=O)N1CC |
| InChI | InChI=1S/C10H20N2O/c1-5-9-8(3)7-11(4)10(13)12(9)6-2/h8-9H,5-7H2,1-4H3 |
| InChIKey | NAIAYJMXPWHJDZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one?
The IUPAC name of 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one (CID 21354350) is 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one.
What is the SMILES notation for 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one?
The canonical SMILES for 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one is CCC1C(C)CN(C)C(=O)N1CC.
What is the InChIKey of 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one?
The InChIKey is NAIAYJMXPWHJDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-5-9-8(3)7-11(4)10(13)12(9)6-2/h8-9H,5-7H2,1-4H3.
What are the key properties of 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one?
3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one has a molecular weight of 184.28 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethyl-1,5-dimethyl-1,3-diazinan-2-one is sourced from PubChem (CID 21354350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).