About 3,4-diethyloxane
3,4-diethyloxane (PubChem CID 21354353) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 3,4-diethyloxane.
Molecular Properties
| Compound Name | 3,4-diethyloxane |
| PubChem CID | 21354353 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 3,4-diethyloxane |
| SMILES | CCC1CCOCC1CC |
| InChI | InChI=1S/C9H18O/c1-3-8-5-6-10-7-9(8)4-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | RYIVMXFLNDAJRC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-diethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethyloxane?
The IUPAC name of 3,4-diethyloxane (CID 21354353) is 3,4-diethyloxane.
What is the SMILES notation for 3,4-diethyloxane?
The canonical SMILES for 3,4-diethyloxane is CCC1CCOCC1CC.
What is the InChIKey of 3,4-diethyloxane?
The InChIKey is RYIVMXFLNDAJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-3-8-5-6-10-7-9(8)4-2/h8-9H,3-7H2,1-2H3.
What are the key properties of 3,4-diethyloxane?
3,4-diethyloxane has a molecular weight of 142.24 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethyloxane is sourced from PubChem (CID 21354353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).