About 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+)
6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+) (PubChem CID 21354478) has the molecular formula C12H22O2V
and a molecular weight of 249.25 g/mol. Its IUPAC name is 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+).
Molecular Properties
| Compound Name | 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+) |
| PubChem CID | 21354478 |
| Molecular Formula | C12H22O2V |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+) |
| SMILES | C[C-](C)C.[CH2-]C(=O)CCC(=O)C(C)C.[V+2] |
| InChI | InChI=1S/C8H13O2.C4H9.V/c1-6(2)8(10)5-4-7(3)9;1-4(2)3;/h6H,3-5H2,1-2H3;1-3H3;/q2*-1;+2 |
| InChIKey | XKAAYCSWSHTVCP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+)?
The IUPAC name of 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+) (CID 21354478) is 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+).
What is the SMILES notation for 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+)?
The canonical SMILES for 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+) is C[C-](C)C.[CH2-]C(=O)CCC(=O)C(C)C.[V+2].
What is the InChIKey of 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+)?
The InChIKey is XKAAYCSWSHTVCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O2.C4H9.V/c1-6(2)8(10)5-4-7(3)9;1-4(2)3;/h6H,3-5H2,1-2H3;1-3H3;/q2*-1;+2.
What are the key properties of 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+)?
6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+) has a molecular weight of 249.25 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptane-2,5-dione;2-methylpropane;vanadium(2+) is sourced from PubChem (CID 21354478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).