C17H12F19NO — CID 21354916
2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-nonadecafluoro-N,N-bis(prop-2-enyl)undecanamide (PubChem CID 21354916) has the molecular formula C17H12F19NO and a molecular weight of 607.25 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-nonadecafluoro-N,N-bis(prop-2-enyl)undecanamide.
| Compound Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-nonadecafluoro-N,N-bis(prop-2-enyl)undecanamide |
|---|---|
| PubChem CID | 21354916 |
| Molecular Formula | C17H12F19NO |
| Molecular Weight | 607.25 g/mol |
| Exact Mass | 607.06 |
| IUPAC Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-nonadecafluoro-N,N-bis(prop-2-enyl)undecanamide |
| SMILES | C=CCN(CC=C)C(=O)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H12F19NO/c1-3-5-37(6-4-2)8(38)7(18)10(21,22)12(25,26)14(29,30)16(33,34)17(35,36)15(31,32)13(27,28)11(23,24)9(19)20/h3-4,7,9H,1-2,5-6H2 |
| InChIKey | CRWGXJAVEXOHTI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.25 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|