About 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole
2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 21355396) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 21355396 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Cc1nn2cc(C(C)C)nc2s1 |
| InChI | InChI=1S/C8H11N3S/c1-5(2)7-4-11-8(9-7)12-6(3)10-11/h4-5H,1-3H3 |
| InChIKey | ZBGPSKIBTFTYIA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole (CID 21355396) is 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole is Cc1nn2cc(C(C)C)nc2s1.
What is the InChIKey of 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is ZBGPSKIBTFTYIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c1-5(2)7-4-11-8(9-7)12-6(3)10-11/h4-5H,1-3H3.
What are the key properties of 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole?
2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 181.26 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 21355396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).