About N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine
N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine (PubChem CID 21355547) has the molecular formula C12H26FN
and a molecular weight of 203.34 g/mol. Its IUPAC name is N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine.
Molecular Properties
| Compound Name | N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine |
| PubChem CID | 21355547 |
| Molecular Formula | C12H26FN |
| Molecular Weight | 203.34 g/mol |
| Exact Mass | 203.20 |
| IUPAC Name | N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine |
| SMILES | CC(C)CC(CC(C)C)NC(C)CF |
| InChI | InChI=1S/C12H26FN/c1-9(2)6-12(7-10(3)4)14-11(5)8-13/h9-12,14H,6-8H2,1-5H3 |
| InChIKey | QHNMVRPQACXXCO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine?
The IUPAC name of N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine (CID 21355547) is N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine.
What is the SMILES notation for N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine?
The canonical SMILES for N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine is CC(C)CC(CC(C)C)NC(C)CF.
What is the InChIKey of N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine?
The InChIKey is QHNMVRPQACXXCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26FN/c1-9(2)6-12(7-10(3)4)14-11(5)8-13/h9-12,14H,6-8H2,1-5H3.
What are the key properties of N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine?
N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine has a molecular weight of 203.34 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-fluoropropan-2-yl)-2,6-dimethylheptan-4-amine is sourced from PubChem (CID 21355547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).