C28H28N2O3 — CID 21355690
(E)-3-[4-(6-hydroxy-2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)phenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 21355690) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is (E)-3-[4-(6-hydroxy-2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)phenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (E)-3-[4-(6-hydroxy-2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)phenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 21355690 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (E)-3-[4-(6-hydroxy-2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)phenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(C2c3ccc(O)cc3CCN2c2ccccc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C28H28N2O3/c31-25-11-12-26-23(20-25)14-15-30(24-4-2-1-3-5-24)28(26)22-9-6-21(7-10-22)8-13-27(32)29-16-18-33-19-17-29/h1-13,20,28,31H,14-19H2/b13-8+ |
| InChIKey | NFAPLEMEIUJIEM-MDWZMJQESA-N |
| XLogP | 4.42 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|