C23H36N2O2S — CID 21355939
N-[3-[(3R,4S)-1-[(E)-3-cyclohexylprop-2-enyl]-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide (PubChem CID 21355939) has the molecular formula C23H36N2O2S and a molecular weight of 404.62 g/mol. Its IUPAC name is N-[3-[(3R,4S)-1-[(E)-3-cyclohexylprop-2-enyl]-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(3R,4S)-1-[(E)-3-cyclohexylprop-2-enyl]-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 21355939 |
| Molecular Formula | C23H36N2O2S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-[3-[(3R,4S)-1-[(E)-3-cyclohexylprop-2-enyl]-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide |
| SMILES | C[C@H]1CN(C/C=C/C2CCCCC2)CC[C@]1(C)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H36N2O2S/c1-19-18-25(15-8-11-20-9-5-4-6-10-20)16-14-23(19,2)21-12-7-13-22(17-21)24-28(3,26)27/h7-8,11-13,17,19-20,24H,4-6,9-10,14-16,18H2,1-3H3/b11-8+/t19-,23-/m0/s1 |
| InChIKey | CTPARJNGWFERFI-MBQYDLODSA-N |
| XLogP | 4.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|