C29H54O3Si2 — CID 21356455
cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-(1-propylcyclobutyl)but-1-enyl]-2-methylidenecyclopentan-1-one (PubChem CID 21356455) has the molecular formula C29H54O3Si2 and a molecular weight of 506.92 g/mol. Its IUPAC name is cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-(1-propylcyclobutyl)but-1-enyl]-2-methylidenecyclopentan-1-one.
| Compound Name | cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-(1-propylcyclobutyl)but-1-enyl]-2-methylidenecyclopentan-1-one |
|---|---|
| PubChem CID | 21356455 |
| Molecular Formula | C29H54O3Si2 |
| Molecular Weight | 506.92 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-(1-propylcyclobutyl)but-1-enyl]-2-methylidenecyclopentan-1-one |
| SMILES | C=C1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/CC(O[Si](C)(C)C(C)(C)C)C1(CCC)CCC1 |
| InChI | InChI=1S/C29H54O3Si2/c1-13-18-29(19-15-20-29)26(32-34(11,12)28(6,7)8)17-14-16-23-22(2)24(30)21-25(23)31-33(9,10)27(3,4)5/h14,16,23,25-26H,2,13,15,17-21H2,1,3-12H3/b16-14+/t23-,25-,26?/m1/s1 |
| InChIKey | YGKGOLKYMWKRIN-GZURBMNCSA-N |
| XLogP | 8.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.92 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|