About N,N'-dimethylcarbamimidothioate;yttrium(3+)
N,N'-dimethylcarbamimidothioate;yttrium(3+) (PubChem CID 21356879) has the molecular formula C3H7N2SY+2
and a molecular weight of 192.08 g/mol. Its IUPAC name is N,N'-dimethylcarbamimidothioate;yttrium(3+).
Molecular Properties
| Compound Name | N,N'-dimethylcarbamimidothioate;yttrium(3+) |
| PubChem CID | 21356879 |
| Molecular Formula | C3H7N2SY+2 |
| Molecular Weight | 192.08 g/mol |
| Exact Mass | 191.94 |
| IUPAC Name | N,N'-dimethylcarbamimidothioate;yttrium(3+) |
| SMILES | C/N=C(\[S-])NC.[Y+3] |
| InChI | InChI=1S/C3H8N2S.Y/c1-4-3(6)5-2;/h1-2H3,(H2,4,5,6);/q;+3/p-1 |
| InChIKey | YZEGIHOYJJHUIO-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.08 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethylcarbamimidothioate;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethylcarbamimidothioate;yttrium(3+)?
The IUPAC name of N,N'-dimethylcarbamimidothioate;yttrium(3+) (CID 21356879) is N,N'-dimethylcarbamimidothioate;yttrium(3+).
What is the SMILES notation for N,N'-dimethylcarbamimidothioate;yttrium(3+)?
The canonical SMILES for N,N'-dimethylcarbamimidothioate;yttrium(3+) is C/N=C(\[S-])NC.[Y+3].
What is the InChIKey of N,N'-dimethylcarbamimidothioate;yttrium(3+)?
The InChIKey is YZEGIHOYJJHUIO-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8N2S.Y/c1-4-3(6)5-2;/h1-2H3,(H2,4,5,6);/q;+3/p-1.
What are the key properties of N,N'-dimethylcarbamimidothioate;yttrium(3+)?
N,N'-dimethylcarbamimidothioate;yttrium(3+) has a molecular weight of 192.08 g/mol, XLogP of -0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethylcarbamimidothioate;yttrium(3+) is sourced from PubChem (CID 21356879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).