C13H19F2O2S- — CID 21357091
5-(1,1-difluorobut-3-enylsulfonyl)nona-1,8-diene (PubChem CID 21357091) has the molecular formula C13H19F2O2S- and a molecular weight of 277.36 g/mol. Its IUPAC name is 5-(1,1-difluorobut-3-enylsulfonyl)nona-1,8-diene.
| Compound Name | 5-(1,1-difluorobut-3-enylsulfonyl)nona-1,8-diene |
|---|---|
| PubChem CID | 21357091 |
| Molecular Formula | C13H19F2O2S- |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-(1,1-difluorobut-3-enylsulfonyl)nona-1,8-diene |
| SMILES | C=CCC[C-](CCC=C)S(=O)(=O)C(F)(F)CC=C |
| InChI | InChI=1S/C13H19F2O2S/c1-4-7-9-12(10-8-5-2)18(16,17)13(14,15)11-6-3/h4-6H,1-3,7-11H2/q-1 |
| InChIKey | XAJIONDPBWPXFS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|