C30H31F2N3O3 — CID 21357393
4-(3,4-difluorophenyl)-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2-oxo-1,3-oxazolidine-3-carboxamide (PubChem CID 21357393) has the molecular formula C30H31F2N3O3 and a molecular weight of 519.59 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2-oxo-1,3-oxazolidine-3-carboxamide.
| Compound Name | 4-(3,4-difluorophenyl)-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2-oxo-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 21357393 |
| Molecular Formula | C30H31F2N3O3 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2-oxo-1,3-oxazolidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCC(c2ccccc2)(c2ccccc2)CC1)N1C(=O)OCC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C30H31F2N3O3/c31-25-13-12-22(20-26(25)32)27-21-38-29(37)35(27)28(36)33-16-7-17-34-18-14-30(15-19-34,23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-13,20,27H,7,14-19,21H2,(H,33,36) |
| InChIKey | XBXLTIHJBYPSMW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|