About methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate
methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate (PubChem CID 21357542) has the molecular formula C11H18N4O5
and a molecular weight of 286.29 g/mol. Its IUPAC name is methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate |
| PubChem CID | 21357542 |
| Molecular Formula | C11H18N4O5 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CNC(=O)CN1C(=O)NC(CN)C1=O |
| InChI | InChI=1S/C11H18N4O5/c1-6(10(18)20-2)4-13-8(16)5-15-9(17)7(3-12)14-11(15)19/h6-7H,3-5,12H2,1-2H3,(H,13,16)(H,14,19) |
| InChIKey | RORVCVGFJICNSU-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate?
The IUPAC name of methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate (CID 21357542) is methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate.
What is the SMILES notation for methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate?
The canonical SMILES for methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate is COC(=O)C(C)CNC(=O)CN1C(=O)NC(CN)C1=O.
What is the InChIKey of methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate?
The InChIKey is RORVCVGFJICNSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O5/c1-6(10(18)20-2)4-13-8(16)5-15-9(17)7(3-12)14-11(15)19/h6-7H,3-5,12H2,1-2H3,(H,13,16)(H,14,19).
What are the key properties of methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate?
methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate has a molecular weight of 286.29 g/mol, XLogP of -2.21, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-[4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoate is sourced from PubChem (CID 21357542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).