C18H24N2O3S — CID 21357685
N-hydroxy-4-[3-methyl-3-(4-methylphenyl)-2-oxopyrrolidin-1-yl]thiane-3-carboxamide (PubChem CID 21357685) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-hydroxy-4-[3-methyl-3-(4-methylphenyl)-2-oxopyrrolidin-1-yl]thiane-3-carboxamide.
| Compound Name | N-hydroxy-4-[3-methyl-3-(4-methylphenyl)-2-oxopyrrolidin-1-yl]thiane-3-carboxamide |
|---|---|
| PubChem CID | 21357685 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-hydroxy-4-[3-methyl-3-(4-methylphenyl)-2-oxopyrrolidin-1-yl]thiane-3-carboxamide |
| SMILES | Cc1ccc(C2(C)CCN(C3CCSCC3C(=O)NO)C2=O)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c1-12-3-5-13(6-4-12)18(2)8-9-20(17(18)22)15-7-10-24-11-14(15)16(21)19-23/h3-6,14-15,23H,7-11H2,1-2H3,(H,19,21) |
| InChIKey | GNZCUEVETWDHNB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|