C21H18F2N4O3S2 — CID 21357963
5-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine (PubChem CID 21357963) has the molecular formula C21H18F2N4O3S2 and a molecular weight of 476.53 g/mol. Its IUPAC name is 5-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine.
| Compound Name | 5-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 21357963 |
| Molecular Formula | C21H18F2N4O3S2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 5-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4ccc(F)c(F)c4)cs3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C21H18F2N4O3S2/c1-28-15-7-11(8-16(29-2)17(15)30-3)25-21-27-19(24)18(32-21)20-26-14(9-31-20)10-4-5-12(22)13(23)6-10/h4-9H,24H2,1-3H3,(H,25,27) |
| InChIKey | XTPKRJRADWNCKJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |