C22H26IN3O — CID 21358885
4-[4-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]propoxy]phenyl]-2-iodobenzonitrile (PubChem CID 21358885) has the molecular formula C22H26IN3O and a molecular weight of 475.37 g/mol. Its IUPAC name is 4-[4-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]propoxy]phenyl]-2-iodobenzonitrile.
| Compound Name | 4-[4-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]propoxy]phenyl]-2-iodobenzonitrile |
|---|---|
| PubChem CID | 21358885 |
| Molecular Formula | C22H26IN3O |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 4-[4-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]propoxy]phenyl]-2-iodobenzonitrile |
| SMILES | CN(C)[C@@H]1CCN(CCCOc2ccc(-c3ccc(C#N)c(I)c3)cc2)C1 |
| InChI | InChI=1S/C22H26IN3O/c1-25(2)20-10-12-26(16-20)11-3-13-27-21-8-6-17(7-9-21)18-4-5-19(15-24)22(23)14-18/h4-9,14,20H,3,10-13,16H2,1-2H3/t20-/m1/s1 |
| InChIKey | JGNDSGYDUNECKP-HXUWFJFHSA-N |
| XLogP | 4.23 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|