About 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide
5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide (PubChem CID 2135896) has the molecular formula C19H21N5O3
and a molecular weight of 367.41 g/mol. Its IUPAC name is 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide |
| PubChem CID | 2135896 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2nnn(CCc3ccccc3)c2N)c1 |
| InChI | InChI=1S/C19H21N5O3/c1-26-14-8-9-16(27-2)15(12-14)21-19(25)17-18(20)24(23-22-17)11-10-13-6-4-3-5-7-13/h3-9,12H,10-11,20H2,1-2H3,(H,21,25) |
| InChIKey | GVPUZAAIOHLOEW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide?
The IUPAC name of 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide (CID 2135896) is 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide.
What is the SMILES notation for 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide?
The canonical SMILES for 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide is COc1ccc(OC)c(NC(=O)c2nnn(CCc3ccccc3)c2N)c1.
What is the InChIKey of 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide?
The InChIKey is GVPUZAAIOHLOEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O3/c1-26-14-8-9-16(27-2)15(12-14)21-19(25)17-18(20)24(23-22-17)11-10-13-6-4-3-5-7-13/h3-9,12H,10-11,20H2,1-2H3,(H,21,25).
What are the key properties of 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide?
5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide has a molecular weight of 367.41 g/mol, XLogP of 2.37, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(2,5-dimethoxyphenyl)-1-(2-phenylethyl)triazole-4-carboxamide is sourced from PubChem (CID 2135896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).