C11H12AcF6O — CID 21360389
actinium;2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 21360389) has the molecular formula C11H12AcF6O and a molecular weight of 501.20 g/mol. Its IUPAC name is actinium;2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | actinium;2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 21360389 |
| Molecular Formula | C11H12AcF6O |
| Molecular Weight | 501.20 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | actinium;2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(CC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F.[Ac] |
| InChI | InChI=1S/C11H12F6O.Ac/c12-10(13,14)9(18,11(15,16)17)5-8-4-6-1-2-7(8)3-6;/h1-2,6-8,18H,3-5H2; |
| InChIKey | CDJXYYSEEDAVJV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|