About actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one
actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one (PubChem CID 21360695) has the molecular formula C12H13AcNO2
and a molecular weight of 430.24 g/mol. Its IUPAC name is actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one.
Molecular Properties
| Compound Name | actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one |
| PubChem CID | 21360695 |
| Molecular Formula | C12H13AcNO2 |
| Molecular Weight | 430.24 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one |
| SMILES | Cc1cc(CO)c2[nH]cc(C)c(=O)c2c1.[Ac] |
| InChI | InChI=1S/C12H13NO2.Ac/c1-7-3-9(6-14)11-10(4-7)12(15)8(2)5-13-11;/h3-5,14H,6H2,1-2H3,(H,13,15); |
| InChIKey | NVKIJTKTCLANGH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one?
The IUPAC name of actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one (CID 21360695) is actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one.
What is the SMILES notation for actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one?
The canonical SMILES for actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one is Cc1cc(CO)c2[nH]cc(C)c(=O)c2c1.[Ac].
What is the InChIKey of actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one?
The InChIKey is NVKIJTKTCLANGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2.Ac/c1-7-3-9(6-14)11-10(4-7)12(15)8(2)5-13-11;/h3-5,14H,6H2,1-2H3,(H,13,15);.
What are the key properties of actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one?
actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one has a molecular weight of 430.24 g/mol, XLogP of 1.64, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;8-(hydroxymethyl)-3,6-dimethyl-1H-quinolin-4-one is sourced from PubChem (CID 21360695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).