C33H66N2O — CID 21360889
2-[3-(decan-2-ylamino)-1-ethyl-2,2,6-trimethyl-4-pentyl-6-propylcyclohexyl]-N-ethylacetamide (PubChem CID 21360889) has the molecular formula C33H66N2O and a molecular weight of 506.90 g/mol. Its IUPAC name is 2-[3-(decan-2-ylamino)-1-ethyl-2,2,6-trimethyl-4-pentyl-6-propylcyclohexyl]-N-ethylacetamide.
| Compound Name | 2-[3-(decan-2-ylamino)-1-ethyl-2,2,6-trimethyl-4-pentyl-6-propylcyclohexyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 21360889 |
| Molecular Formula | C33H66N2O |
| Molecular Weight | 506.90 g/mol |
| Exact Mass | 506.52 |
| IUPAC Name | 2-[3-(decan-2-ylamino)-1-ethyl-2,2,6-trimethyl-4-pentyl-6-propylcyclohexyl]-N-ethylacetamide |
| SMILES | CCCCCCCCC(C)NC1C(CCCCC)CC(C)(CCC)C(CC)(CC(=O)NCC)C1(C)C |
| InChI | InChI=1S/C33H66N2O/c1-10-15-17-18-19-21-22-27(6)35-30-28(23-20-16-11-2)25-32(9,24-12-3)33(13-4,31(30,7)8)26-29(36)34-14-5/h27-28,30,35H,10-26H2,1-9H3,(H,34,36) |
| InChIKey | QPHWRJMTYIMRHA-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.90 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|