About 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine
2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine (PubChem CID 21361117) has the molecular formula C6H15N5
and a molecular weight of 157.22 g/mol. Its IUPAC name is 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine.
Molecular Properties
| Compound Name | 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine |
| PubChem CID | 21361117 |
| Molecular Formula | C6H15N5 |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine |
| SMILES | CC/N=C(\N)N/C(N)=N/CC |
| InChI | InChI=1S/C6H15N5/c1-3-9-5(7)11-6(8)10-4-2/h3-4H2,1-2H3,(H5,7,8,9,10,11) |
| InChIKey | CMEIYVWWZREFEM-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine?
The IUPAC name of 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine (CID 21361117) is 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine.
What is the SMILES notation for 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine?
The canonical SMILES for 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine is CC/N=C(\N)N/C(N)=N/CC.
What is the InChIKey of 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine?
The InChIKey is CMEIYVWWZREFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N5/c1-3-9-5(7)11-6(8)10-4-2/h3-4H2,1-2H3,(H5,7,8,9,10,11).
What are the key properties of 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine?
2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine has a molecular weight of 157.22 g/mol, XLogP of -0.75, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-(N'-ethylcarbamimidoyl)guanidine is sourced from PubChem (CID 21361117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).