C15H25N — CID 21361118
N,2,3,4,5,6-hexamethyl-N-propan-2-ylaniline (PubChem CID 21361118) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N,2,3,4,5,6-hexamethyl-N-propan-2-ylaniline.
| Compound Name | N,2,3,4,5,6-hexamethyl-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 21361118 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N,2,3,4,5,6-hexamethyl-N-propan-2-ylaniline |
| SMILES | Cc1c(C)c(C)c(N(C)C(C)C)c(C)c1C |
| InChI | InChI=1S/C15H25N/c1-9(2)16(8)15-13(6)11(4)10(3)12(5)14(15)7/h9H,1-8H3 |
| InChIKey | LWMXVDFYFBWYBF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |