C7H7F9O2 — CID 21361121
1,1,1,3,3,4-hexafluoro-2-(2,2,2-trifluoroethoxymethoxy)butane (PubChem CID 21361121) has the molecular formula C7H7F9O2 and a molecular weight of 294.11 g/mol. Its IUPAC name is 1,1,1,3,3,4-hexafluoro-2-(2,2,2-trifluoroethoxymethoxy)butane.
| Compound Name | 1,1,1,3,3,4-hexafluoro-2-(2,2,2-trifluoroethoxymethoxy)butane |
|---|---|
| PubChem CID | 21361121 |
| Molecular Formula | C7H7F9O2 |
| Molecular Weight | 294.11 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1,1,1,3,3,4-hexafluoro-2-(2,2,2-trifluoroethoxymethoxy)butane |
| SMILES | FCC(F)(F)C(OCOCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H7F9O2/c8-1-5(9,10)4(7(14,15)16)18-3-17-2-6(11,12)13/h4H,1-3H2 |
| InChIKey | GZJZDULHUKFFIF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|