C7H6F10O2 — CID 21361122
1,1,1,4,4,4-hexafluoro-2-(1,2,2,2-tetrafluoroethoxymethoxy)butane (PubChem CID 21361122) has the molecular formula C7H6F10O2 and a molecular weight of 312.10 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-2-(1,2,2,2-tetrafluoroethoxymethoxy)butane.
| Compound Name | 1,1,1,4,4,4-hexafluoro-2-(1,2,2,2-tetrafluoroethoxymethoxy)butane |
|---|---|
| PubChem CID | 21361122 |
| Molecular Formula | C7H6F10O2 |
| Molecular Weight | 312.10 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-2-(1,2,2,2-tetrafluoroethoxymethoxy)butane |
| SMILES | FC(OCOC(CC(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F10O2/c8-4(7(15,16)17)19-2-18-3(6(12,13)14)1-5(9,10)11/h3-4H,1-2H2 |
| InChIKey | GDXLZLMOWACTAO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.10 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|