C15H38O4Si4 — CID 21361158
2-ethyl-2,4,6,8-tetramethyl-4,6,8-tripropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 21361158) has the molecular formula C15H38O4Si4 and a molecular weight of 394.81 g/mol. Its IUPAC name is 2-ethyl-2,4,6,8-tetramethyl-4,6,8-tripropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-ethyl-2,4,6,8-tetramethyl-4,6,8-tripropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 21361158 |
| Molecular Formula | C15H38O4Si4 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-ethyl-2,4,6,8-tetramethyl-4,6,8-tripropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC[Si]1(C)O[Si](C)(CC)O[Si](C)(CCC)O[Si](C)(CCC)O1 |
| InChI | InChI=1S/C15H38O4Si4/c1-9-13-21(6)16-20(5,12-4)17-22(7,14-10-2)19-23(8,18-21)15-11-3/h9-15H2,1-8H3 |
| InChIKey | QSRFJEUZMOIDNS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|