About butane;carbanide;dichlororuthenium
butane;carbanide;dichlororuthenium (PubChem CID 21361201) has the molecular formula C5H11Cl2Ru-3
and a molecular weight of 243.12 g/mol. Its IUPAC name is butane;carbanide;dichlororuthenium.
Molecular Properties
| Compound Name | butane;carbanide;dichlororuthenium |
| PubChem CID | 21361201 |
| Molecular Formula | C5H11Cl2Ru-3 |
| Molecular Weight | 243.12 g/mol |
| Exact Mass | 242.93 |
| IUPAC Name | butane;carbanide;dichlororuthenium |
| SMILES | Cl[Ru]Cl.[CH2-]C[CH-]C.[CH3-] |
| InChI | InChI=1S/C4H8.CH3.2ClH.Ru/c1-3-4-2;;;;/h4H,1,3H2,2H3;1H3;2*1H;/q-2;-1;;;+2/p-2 |
| InChIKey | KKCCTVMLNLJEJP-UHFFFAOYSA-L |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.12 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butane;carbanide;dichlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;carbanide;dichlororuthenium?
The IUPAC name of butane;carbanide;dichlororuthenium (CID 21361201) is butane;carbanide;dichlororuthenium.
What is the SMILES notation for butane;carbanide;dichlororuthenium?
The canonical SMILES for butane;carbanide;dichlororuthenium is Cl[Ru]Cl.[CH2-]C[CH-]C.[CH3-].
What is the InChIKey of butane;carbanide;dichlororuthenium?
The InChIKey is KKCCTVMLNLJEJP-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H8.CH3.2ClH.Ru/c1-3-4-2;;;;/h4H,1,3H2,2H3;1H3;2*1H;/q-2;-1;;;+2/p-2.
What are the key properties of butane;carbanide;dichlororuthenium?
butane;carbanide;dichlororuthenium has a molecular weight of 243.12 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;carbanide;dichlororuthenium is sourced from PubChem (CID 21361201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).