About 2-methoxy-1,3,4-trimethyl-2H-imidazole
2-methoxy-1,3,4-trimethyl-2H-imidazole (PubChem CID 21361202) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-methoxy-1,3,4-trimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 2-methoxy-1,3,4-trimethyl-2H-imidazole |
| PubChem CID | 21361202 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2-methoxy-1,3,4-trimethyl-2H-imidazole |
| SMILES | COC1N(C)C=C(C)N1C |
| InChI | InChI=1S/C7H14N2O/c1-6-5-8(2)7(10-4)9(6)3/h5,7H,1-4H3 |
| InChIKey | FFUKLKBJRREVJH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-1,3,4-trimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1,3,4-trimethyl-2H-imidazole?
The IUPAC name of 2-methoxy-1,3,4-trimethyl-2H-imidazole (CID 21361202) is 2-methoxy-1,3,4-trimethyl-2H-imidazole.
What is the SMILES notation for 2-methoxy-1,3,4-trimethyl-2H-imidazole?
The canonical SMILES for 2-methoxy-1,3,4-trimethyl-2H-imidazole is COC1N(C)C=C(C)N1C.
What is the InChIKey of 2-methoxy-1,3,4-trimethyl-2H-imidazole?
The InChIKey is FFUKLKBJRREVJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-6-5-8(2)7(10-4)9(6)3/h5,7H,1-4H3.
What are the key properties of 2-methoxy-1,3,4-trimethyl-2H-imidazole?
2-methoxy-1,3,4-trimethyl-2H-imidazole has a molecular weight of 142.20 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1,3,4-trimethyl-2H-imidazole is sourced from PubChem (CID 21361202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).