C16H28N2O2 — CID 21361280
1-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 21361280) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 21361280 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CCC1(C)CC(N2C(=O)CCC2=O)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C16H28N2O2/c1-6-15(4)10-12(11(3)16(5,7-2)17-15)18-13(19)8-9-14(18)20/h11-12,17H,6-10H2,1-5H3 |
| InChIKey | RHFGTBIWQDBXJK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|