About 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate
2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate (PubChem CID 21361302) has the molecular formula C22H33NO5
and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate.
Molecular Properties
| Compound Name | 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate |
| PubChem CID | 21361302 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate |
| SMILES | CCC1(CC)CC(OC(=O)C(=O)OC)CC(C)(C)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C22H33NO5/c1-7-22(8-2)15-18(27-20(25)19(24)26-6)14-21(4,5)23(22)28-16(3)17-12-10-9-11-13-17/h9-13,16,18H,7-8,14-15H2,1-6H3 |
| InChIKey | FFGXSMDODDNOIY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate?
The IUPAC name of 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate (CID 21361302) is 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate.
What is the SMILES notation for 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate?
The canonical SMILES for 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate is CCC1(CC)CC(OC(=O)C(=O)OC)CC(C)(C)N1OC(C)c1ccccc1.
What is the InChIKey of 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate?
The InChIKey is FFGXSMDODDNOIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33NO5/c1-7-22(8-2)15-18(27-20(25)19(24)26-6)14-21(4,5)23(22)28-16(3)17-12-10-9-11-13-17/h9-13,16,18H,7-8,14-15H2,1-6H3.
What are the key properties of 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate?
2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate has a molecular weight of 391.51 g/mol, XLogP of 4.20, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl oxalate is sourced from PubChem (CID 21361302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).