About 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine
2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine (PubChem CID 21361325) has the molecular formula C19H32N2O
and a molecular weight of 304.48 g/mol. Its IUPAC name is 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine.
Molecular Properties
| Compound Name | 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine |
| PubChem CID | 21361325 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine |
| SMILES | CCC1(CC)CC(N)CC(C)(C)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C19H32N2O/c1-6-19(7-2)14-17(20)13-18(4,5)21(19)22-15(3)16-11-9-8-10-12-16/h8-12,15,17H,6-7,13-14,20H2,1-5H3 |
| InChIKey | YZQUGBGZUANNEN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine?
The IUPAC name of 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine (CID 21361325) is 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine.
What is the SMILES notation for 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine?
The canonical SMILES for 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine is CCC1(CC)CC(N)CC(C)(C)N1OC(C)c1ccccc1.
What is the InChIKey of 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine?
The InChIKey is YZQUGBGZUANNEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O/c1-6-19(7-2)14-17(20)13-18(4,5)21(19)22-15(3)16-11-9-8-10-12-16/h8-12,15,17H,6-7,13-14,20H2,1-5H3.
What are the key properties of 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine?
2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine has a molecular weight of 304.48 g/mol, XLogP of 4.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-amine is sourced from PubChem (CID 21361325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).