C18H29F3O3 — CID 21361763
[1-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-4-propan-2-yloxybutyl] 2,2,2-trifluoroacetate (PubChem CID 21361763) has the molecular formula C18H29F3O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is [1-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-4-propan-2-yloxybutyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-4-propan-2-yloxybutyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 21361763 |
| Molecular Formula | C18H29F3O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [1-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)-4-propan-2-yloxybutyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)OCCCC(OC(=O)C(F)(F)F)C1CC2CC1C(C)C2C |
| InChI | InChI=1S/C18H29F3O3/c1-10(2)23-7-5-6-16(24-17(22)18(19,20)21)15-9-13-8-14(15)12(4)11(13)3/h10-16H,5-9H2,1-4H3 |
| InChIKey | AAEQYCWJLKGLFB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|