C17H18ClIN2O3S — CID 2136188
4-[(4-chlorophenyl)sulfonyl-methylamino]-N-(2-iodophenyl)butanamide (PubChem CID 2136188) has the molecular formula C17H18ClIN2O3S and a molecular weight of 492.77 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfonyl-methylamino]-N-(2-iodophenyl)butanamide.
| Compound Name | 4-[(4-chlorophenyl)sulfonyl-methylamino]-N-(2-iodophenyl)butanamide |
|---|---|
| PubChem CID | 2136188 |
| Molecular Formula | C17H18ClIN2O3S |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfonyl-methylamino]-N-(2-iodophenyl)butanamide |
| SMILES | CN(CCCC(=O)Nc1ccccc1I)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClIN2O3S/c1-21(25(23,24)14-10-8-13(18)9-11-14)12-4-7-17(22)20-16-6-3-2-5-15(16)19/h2-3,5-6,8-11H,4,7,12H2,1H3,(H,20,22) |
| InChIKey | MSEZMBAFCWGPTC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|