C19H30O — CID 21362325
2-[(3,5-dimethylphenyl)methyl]-6-ethyl-3,4,5-trimethyloxane (PubChem CID 21362325) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methyl]-6-ethyl-3,4,5-trimethyloxane.
| Compound Name | 2-[(3,5-dimethylphenyl)methyl]-6-ethyl-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 21362325 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methyl]-6-ethyl-3,4,5-trimethyloxane |
| SMILES | CCC1OC(Cc2cc(C)cc(C)c2)C(C)C(C)C1C |
| InChI | InChI=1S/C19H30O/c1-7-18-15(5)14(4)16(6)19(20-18)11-17-9-12(2)8-13(3)10-17/h8-10,14-16,18-19H,7,11H2,1-6H3 |
| InChIKey | VQMKITVFHXXUBH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |