C11H20O — CID 21362336
2-ethyl-3,4,5-trimethyl-6-methylideneoxane (PubChem CID 21362336) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-ethyl-3,4,5-trimethyl-6-methylideneoxane.
| Compound Name | 2-ethyl-3,4,5-trimethyl-6-methylideneoxane |
|---|---|
| PubChem CID | 21362336 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 2-ethyl-3,4,5-trimethyl-6-methylideneoxane |
| SMILES | C=C1OC(CC)C(C)C(C)C1C |
| InChI | InChI=1S/C11H20O/c1-6-11-9(4)7(2)8(3)10(5)12-11/h7-9,11H,5-6H2,1-4H3 |
| InChIKey | YJWUYUIGULWMBK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |