C25H27FO5 — CID 21362660
ethyl 2-[(4-fluorophenyl)-(5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)methyl]-4-methyl-3-oxopentanoate (PubChem CID 21362660) has the molecular formula C25H27FO5 and a molecular weight of 426.48 g/mol. Its IUPAC name is ethyl 2-[(4-fluorophenyl)-(5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)methyl]-4-methyl-3-oxopentanoate.
| Compound Name | ethyl 2-[(4-fluorophenyl)-(5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)methyl]-4-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 21362660 |
| Molecular Formula | C25H27FO5 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | ethyl 2-[(4-fluorophenyl)-(5-oxo-3,4-dihydro-2H-1-benzoxepin-4-yl)methyl]-4-methyl-3-oxopentanoate |
| SMILES | CCOC(=O)C(C(=O)C(C)C)C(c1ccc(F)cc1)C1CCOc2ccccc2C1=O |
| InChI | InChI=1S/C25H27FO5/c1-4-30-25(29)22(23(27)15(2)3)21(16-9-11-17(26)12-10-16)19-13-14-31-20-8-6-5-7-18(20)24(19)28/h5-12,15,19,21-22H,4,13-14H2,1-3H3 |
| InChIKey | JPWOTLPBMVOCTD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|