About 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole
6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole (PubChem CID 21362696) has the molecular formula C15H12Cl2N2O
and a molecular weight of 307.18 g/mol. Its IUPAC name is 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole |
| PubChem CID | 21362696 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole |
| SMILES | Clc1cc2c([nH]c3cnccc32)c(Cl)c1OCC1CC1 |
| InChI | InChI=1S/C15H12Cl2N2O/c16-11-5-10-9-3-4-18-6-12(9)19-14(10)13(17)15(11)20-7-8-1-2-8/h3-6,8,19H,1-2,7H2 |
| InChIKey | UHUORUOGWKYIIT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole?
The IUPAC name of 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole (CID 21362696) is 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole?
The canonical SMILES for 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole is Clc1cc2c([nH]c3cnccc32)c(Cl)c1OCC1CC1.
What is the InChIKey of 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole?
The InChIKey is UHUORUOGWKYIIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2N2O/c16-11-5-10-9-3-4-18-6-12(9)19-14(10)13(17)15(11)20-7-8-1-2-8/h3-6,8,19H,1-2,7H2.
What are the key properties of 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole?
6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole has a molecular weight of 307.18 g/mol, XLogP of 4.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-7-(cyclopropylmethoxy)-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 21362696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).