About N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide
N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide (PubChem CID 21362732) has the molecular formula C13H10ClN3O
and a molecular weight of 259.70 g/mol. Its IUPAC name is N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide |
| PubChem CID | 21362732 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide |
| SMILES | CC(=O)Nc1cc(Cl)cc2c1[nH]c1cnccc12 |
| InChI | InChI=1S/C13H10ClN3O/c1-7(18)16-11-5-8(14)4-10-9-2-3-15-6-12(9)17-13(10)11/h2-6,17H,1H3,(H,16,18) |
| InChIKey | UNYBDMHTBISCGP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide?
The IUPAC name of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide (CID 21362732) is N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide.
What is the SMILES notation for N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide?
The canonical SMILES for N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide is CC(=O)Nc1cc(Cl)cc2c1[nH]c1cnccc12.
What is the InChIKey of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide?
The InChIKey is UNYBDMHTBISCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3O/c1-7(18)16-11-5-8(14)4-10-9-2-3-15-6-12(9)17-13(10)11/h2-6,17H,1H3,(H,16,18).
What are the key properties of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide?
N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide has a molecular weight of 259.70 g/mol, XLogP of 3.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)acetamide is sourced from PubChem (CID 21362732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).