About N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide
N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide (PubChem CID 21362756) has the molecular formula C12H10ClN3O2S
and a molecular weight of 295.75 g/mol. Its IUPAC name is N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide |
| PubChem CID | 21362756 |
| Molecular Formula | C12H10ClN3O2S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(Cl)cc2c1[nH]c1cnccc12 |
| InChI | InChI=1S/C12H10ClN3O2S/c1-19(17,18)16-10-5-7(13)4-9-8-2-3-14-6-11(8)15-12(9)10/h2-6,15-16H,1H3 |
| InChIKey | YKCBNFRVVULBIA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide?
The IUPAC name of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide (CID 21362756) is N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide.
What is the SMILES notation for N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide?
The canonical SMILES for N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide is CS(=O)(=O)Nc1cc(Cl)cc2c1[nH]c1cnccc12.
What is the InChIKey of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide?
The InChIKey is YKCBNFRVVULBIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3O2S/c1-19(17,18)16-10-5-7(13)4-9-8-2-3-14-6-11(8)15-12(9)10/h2-6,15-16H,1H3.
What are the key properties of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide?
N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide has a molecular weight of 295.75 g/mol, XLogP of 2.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)methanesulfonamide is sourced from PubChem (CID 21362756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).