C26H31NO4 — CID 21362776
7-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-8-ol (PubChem CID 21362776) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 7-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-8-ol.
| Compound Name | 7-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-8-ol |
|---|---|
| PubChem CID | 21362776 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 7-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-8-ol |
| SMILES | COc1cc2c(c(O)c1-c1ccc(OC)c3c(OC)cc(C)cc13)C(C)N(C)C(C)C2 |
| InChI | InChI=1S/C26H31NO4/c1-14-10-19-18(8-9-20(29-5)24(19)21(11-14)30-6)25-22(31-7)13-17-12-15(2)27(4)16(3)23(17)26(25)28/h8-11,13,15-16,28H,12H2,1-7H3 |
| InChIKey | JBWZTBPMUIIELC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|